About N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide
N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide (PubChem CID 129144892) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide.
Molecular Properties
| Compound Name | N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide |
| PubChem CID | 129144892 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide |
| SMILES | C=N/C=N\NC(=C)C |
| InChI | InChI=1S/C5H9N3/c1-5(2)8-7-4-6-3/h4,8H,1,3H2,2H3/b7-4- |
| InChIKey | AWHFPSIZZHLWNO-DAXSKMNVSA-N |
| XLogP | 0.75 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide?
The IUPAC name of N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide (CID 129144892) is N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide.
What is the SMILES notation for N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide?
The canonical SMILES for N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide is C=N/C=N\NC(=C)C.
What is the InChIKey of N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide?
The InChIKey is AWHFPSIZZHLWNO-DAXSKMNVSA-N. The full InChI is InChI=1S/C5H9N3/c1-5(2)8-7-4-6-3/h4,8H,1,3H2,2H3/b7-4-.
What are the key properties of N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide?
N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide has a molecular weight of 111.15 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidene-N'-(prop-1-en-2-ylamino)methanimidamide is sourced from PubChem (CID 129144892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).