About 8-methylidene-3,7-dihydropyrido[4,3-b]azepine
8-methylidene-3,7-dihydropyrido[4,3-b]azepine (PubChem CID 129144955) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 8-methylidene-3,7-dihydropyrido[4,3-b]azepine.
Molecular Properties
| Compound Name | 8-methylidene-3,7-dihydropyrido[4,3-b]azepine |
| PubChem CID | 129144955 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 8-methylidene-3,7-dihydropyrido[4,3-b]azepine |
| SMILES | C=C1C=C2N=CCC=CC2=CN1 |
| InChI | InChI=1S/C10H10N2/c1-8-6-10-9(7-12-8)4-2-3-5-11-10/h2,4-7,12H,1,3H2 |
| InChIKey | LBENMODGUWZZOR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methylidene-3,7-dihydropyrido[4,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylidene-3,7-dihydropyrido[4,3-b]azepine?
The IUPAC name of 8-methylidene-3,7-dihydropyrido[4,3-b]azepine (CID 129144955) is 8-methylidene-3,7-dihydropyrido[4,3-b]azepine.
What is the SMILES notation for 8-methylidene-3,7-dihydropyrido[4,3-b]azepine?
The canonical SMILES for 8-methylidene-3,7-dihydropyrido[4,3-b]azepine is C=C1C=C2N=CCC=CC2=CN1.
What is the InChIKey of 8-methylidene-3,7-dihydropyrido[4,3-b]azepine?
The InChIKey is LBENMODGUWZZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-8-6-10-9(7-12-8)4-2-3-5-11-10/h2,4-7,12H,1,3H2.
What are the key properties of 8-methylidene-3,7-dihydropyrido[4,3-b]azepine?
8-methylidene-3,7-dihydropyrido[4,3-b]azepine has a molecular weight of 158.20 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylidene-3,7-dihydropyrido[4,3-b]azepine is sourced from PubChem (CID 129144955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).