About N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide
N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 129145041) has the molecular formula C18H18F3N3O2
and a molecular weight of 365.36 g/mol. Its IUPAC name is N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| PubChem CID | 129145041 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | C[C@@H]1CNC[C@H](c2ccc(NC(=O)c3ccc(C(F)(F)F)nc3)cc2)O1 |
| InChI | InChI=1S/C18H18F3N3O2/c1-11-8-22-10-15(26-11)12-2-5-14(6-3-12)24-17(25)13-4-7-16(23-9-13)18(19,20)21/h2-7,9,11,15,22H,8,10H2,1H3,(H,24,25)/t11-,15-/m1/s1 |
| InChIKey | WSNYSXWCNLZHFR-IAQYHMDHSA-N |
| XLogP | 3.40 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The IUPAC name of N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide (CID 129145041) is N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
What is the SMILES notation for N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The canonical SMILES for N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide is C[C@@H]1CNC[C@H](c2ccc(NC(=O)c3ccc(C(F)(F)F)nc3)cc2)O1.
What is the InChIKey of N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The InChIKey is WSNYSXWCNLZHFR-IAQYHMDHSA-N. The full InChI is InChI=1S/C18H18F3N3O2/c1-11-8-22-10-15(26-11)12-2-5-14(6-3-12)24-17(25)13-4-7-16(23-9-13)18(19,20)21/h2-7,9,11,15,22H,8,10H2,1H3,(H,24,25)/t11-,15-/m1/s1.
What are the key properties of N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide has a molecular weight of 365.36 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2S,6R)-6-methylmorpholin-2-yl]phenyl]-6-(trifluoromethyl)pyridine-3-carboxamide is sourced from PubChem (CID 129145041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).