About 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine
2-methylidene-5,6-dihydro-1H-1,7-naphthyridine (PubChem CID 129145137) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine.
Molecular Properties
| Compound Name | 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine |
| PubChem CID | 129145137 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine |
| SMILES | C=C1C=CC2=C(C=NCC2)N1 |
| InChI | InChI=1S/C9H10N2/c1-7-2-3-8-4-5-10-6-9(8)11-7/h2-3,6,11H,1,4-5H2 |
| InChIKey | XPFMBTVTWHYNGY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine?
The IUPAC name of 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine (CID 129145137) is 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine.
What is the SMILES notation for 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine?
The canonical SMILES for 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine is C=C1C=CC2=C(C=NCC2)N1.
What is the InChIKey of 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine?
The InChIKey is XPFMBTVTWHYNGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-2-3-8-4-5-10-6-9(8)11-7/h2-3,6,11H,1,4-5H2.
What are the key properties of 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine?
2-methylidene-5,6-dihydro-1H-1,7-naphthyridine has a molecular weight of 146.19 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5,6-dihydro-1H-1,7-naphthyridine is sourced from PubChem (CID 129145137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).