About 7-(methoxymethyl)-5,6-dihydrochromen-4-one
7-(methoxymethyl)-5,6-dihydrochromen-4-one (PubChem CID 129145777) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 7-(methoxymethyl)-5,6-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 7-(methoxymethyl)-5,6-dihydrochromen-4-one |
| PubChem CID | 129145777 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 7-(methoxymethyl)-5,6-dihydrochromen-4-one |
| SMILES | COCC1=Cc2occc(=O)c2CC1 |
| InChI | InChI=1S/C11H12O3/c1-13-7-8-2-3-9-10(12)4-5-14-11(9)6-8/h4-6H,2-3,7H2,1H3 |
| InChIKey | UJQLBOQBTCYERM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(methoxymethyl)-5,6-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(methoxymethyl)-5,6-dihydrochromen-4-one?
The IUPAC name of 7-(methoxymethyl)-5,6-dihydrochromen-4-one (CID 129145777) is 7-(methoxymethyl)-5,6-dihydrochromen-4-one.
What is the SMILES notation for 7-(methoxymethyl)-5,6-dihydrochromen-4-one?
The canonical SMILES for 7-(methoxymethyl)-5,6-dihydrochromen-4-one is COCC1=Cc2occc(=O)c2CC1.
What is the InChIKey of 7-(methoxymethyl)-5,6-dihydrochromen-4-one?
The InChIKey is UJQLBOQBTCYERM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-13-7-8-2-3-9-10(12)4-5-14-11(9)6-8/h4-6H,2-3,7H2,1H3.
What are the key properties of 7-(methoxymethyl)-5,6-dihydrochromen-4-one?
7-(methoxymethyl)-5,6-dihydrochromen-4-one has a molecular weight of 192.21 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(methoxymethyl)-5,6-dihydrochromen-4-one is sourced from PubChem (CID 129145777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).