C28H32ClF5N4O3 — CID 129145821
2-chloro-N,N-dimethyl-6-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 129145821) has the molecular formula C28H32ClF5N4O3 and a molecular weight of 603.03 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-6-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N,N-dimethyl-6-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129145821 |
| Molecular Formula | C28H32ClF5N4O3 |
| Molecular Weight | 603.03 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 2-chloro-N,N-dimethyl-6-[4-[1-[(2R)-3,3,4,4,4-pentafluoro-2-hydroxy-2-phenylbutanoyl]piperidin-4-yl]piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(C3CCN(C(=O)[C@](O)(c4ccccc4)C(F)(F)C(F)(F)F)CC3)CC2)nc1Cl |
| InChI | InChI=1S/C28H32ClF5N4O3/c1-36(2)24(39)21-8-9-22(35-23(21)29)37-14-10-18(11-15-37)19-12-16-38(17-13-19)25(40)26(41,20-6-4-3-5-7-20)27(30,31)28(32,33)34/h3-9,18-19,41H,10-17H2,1-2H3/t26-/m1/s1 |
| InChIKey | WNSGTDRUPSFMBZ-AREMUKBSSA-N |
| XLogP | 4.98 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.03 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|