C25H29ClF2N4O2 — CID 129146147
2-chloro-6-[4-[1-(2,6-difluorobenzoyl)piperidin-4-yl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 129146147) has the molecular formula C25H29ClF2N4O2 and a molecular weight of 490.98 g/mol. Its IUPAC name is 2-chloro-6-[4-[1-(2,6-difluorobenzoyl)piperidin-4-yl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[4-[1-(2,6-difluorobenzoyl)piperidin-4-yl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 129146147 |
| Molecular Formula | C25H29ClF2N4O2 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-chloro-6-[4-[1-(2,6-difluorobenzoyl)piperidin-4-yl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(C3CCN(C(=O)c4c(F)cccc4F)CC3)CC2)nc1Cl |
| InChI | InChI=1S/C25H29ClF2N4O2/c1-30(2)24(33)18-6-7-21(29-23(18)26)31-12-8-16(9-13-31)17-10-14-32(15-11-17)25(34)22-19(27)4-3-5-20(22)28/h3-7,16-17H,8-15H2,1-2H3 |
| InChIKey | LHZKHGMZAWPKKK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|