N-cyclohexylsulfamoyl chloride

C6H12ClNO2S — CID 12914615

IUPACN-cyclohexylsulfamoyl chloride
SMILESO=S(=O)(Cl)NC1CCCCC1
InChIInChI=1S/C6H12ClNO2S/c7-11(9,10)8-6-4-2-1-3-5-6/h6,8H,1-5H2
InChIKeyFGZSEUXOFDMNEL-UHFFFAOYSA-N
MW197.69 g/mol
LogP1.39
Rot. Bonds2

About N-cyclohexylsulfamoyl chloride

N-cyclohexylsulfamoyl chloride (PubChem CID 12914615) has the molecular formula C6H12ClNO2S and a molecular weight of 197.69 g/mol. Its IUPAC name is N-cyclohexylsulfamoyl chloride.

Molecular Properties

Compound NameN-cyclohexylsulfamoyl chloride
PubChem CID12914615
Molecular FormulaC6H12ClNO2S
Molecular Weight197.69 g/mol
Exact Mass197.03
IUPAC NameN-cyclohexylsulfamoyl chloride
SMILESO=S(=O)(Cl)NC1CCCCC1
InChIInChI=1S/C6H12ClNO2S/c7-11(9,10)8-6-4-2-1-3-5-6/h6,8H,1-5H2
InChIKeyFGZSEUXOFDMNEL-UHFFFAOYSA-N
XLogP1.39
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.69
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-cyclohexylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclohexylsulfamoyl chloride?
The IUPAC name of N-cyclohexylsulfamoyl chloride (CID 12914615) is N-cyclohexylsulfamoyl chloride.
What is the SMILES notation for N-cyclohexylsulfamoyl chloride?
The canonical SMILES for N-cyclohexylsulfamoyl chloride is O=S(=O)(Cl)NC1CCCCC1.
What is the InChIKey of N-cyclohexylsulfamoyl chloride?
The InChIKey is FGZSEUXOFDMNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO2S/c7-11(9,10)8-6-4-2-1-3-5-6/h6,8H,1-5H2.
What are the key properties of N-cyclohexylsulfamoyl chloride?
N-cyclohexylsulfamoyl chloride has a molecular weight of 197.69 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylsulfamoyl chloride is sourced from PubChem (CID 12914615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).