C21H30O6 — CID 129146388
[(1R,2S,6R,10S,11R,13S)-1,5,6-trihydroxy-8-(hydroxymethyl)-4,12,12-trimethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate (PubChem CID 129146388) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(1R,2S,6R,10S,11R,13S)-1,5,6-trihydroxy-8-(hydroxymethyl)-4,12,12-trimethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate.
| Compound Name | [(1R,2S,6R,10S,11R,13S)-1,5,6-trihydroxy-8-(hydroxymethyl)-4,12,12-trimethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
|---|---|
| PubChem CID | 129146388 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(1R,2S,6R,10S,11R,13S)-1,5,6-trihydroxy-8-(hydroxymethyl)-4,12,12-trimethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
| SMILES | CC(=O)O[C@@]12CC[C@@]3(O)[C@@H](C=C(CO)C[C@]4(O)C(O)C(C)=C[C@@H]34)[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H30O6/c1-11-7-15-19(25)5-6-21(27-12(2)23)16(18(21,3)4)14(19)8-13(10-22)9-20(15,26)17(11)24/h7-8,14-17,22,24-26H,5-6,9-10H2,1-4H3/t14-,15-,16+,17?,19+,20+,21-/m0/s1 |
| InChIKey | GRNLXGPDYNVFGE-UOOVKGKGSA-N |
| XLogP | 1.08 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|