About N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine
N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 129146487) has the molecular formula C22H27N3S
and a molecular weight of 365.55 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine |
| PubChem CID | 129146487 |
| Molecular Formula | C22H27N3S |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CCCCC(C)N(/N=C/c1cc(C)ccc1C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H27N3S/c1-5-6-9-18(4)25(22-24-20-10-7-8-11-21(20)26-22)23-15-19-14-16(2)12-13-17(19)3/h7-8,10-15,18H,5-6,9H2,1-4H3/b23-15+ |
| InChIKey | WIPKZCIDLHWMGW-HZHRSRAPSA-N |
| XLogP | 6.33 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine?
The IUPAC name of N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine (CID 129146487) is N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine is CCCCC(C)N(/N=C/c1cc(C)ccc1C)c1nc2ccccc2s1.
What is the InChIKey of N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine?
The InChIKey is WIPKZCIDLHWMGW-HZHRSRAPSA-N. The full InChI is InChI=1S/C22H27N3S/c1-5-6-9-18(4)25(22-24-20-10-7-8-11-21(20)26-22)23-15-19-14-16(2)12-13-17(19)3/h7-8,10-15,18H,5-6,9H2,1-4H3/b23-15+.
What are the key properties of N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine?
N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine has a molecular weight of 365.55 g/mol, XLogP of 6.33, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(2,5-dimethylphenyl)methylideneamino]-N-hexan-2-yl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 129146487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).