C25H26O3 — CID 129147178
(2R,6S)-4-[4-(4-ethylphenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 129147178) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is (2R,6S)-4-[4-(4-ethylphenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (2R,6S)-4-[4-(4-ethylphenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 129147178 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (2R,6S)-4-[4-(4-ethylphenyl)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1ccc(-c2cc(C)c(C3C(=O)[C@@H]4C5CCC(O5)[C@@H]4C3=O)c(C)c2)cc1 |
| InChI | InChI=1S/C25H26O3/c1-4-15-5-7-16(8-6-15)17-11-13(2)20(14(3)12-17)23-24(26)21-18-9-10-19(28-18)22(21)25(23)27/h5-8,11-12,18-19,21-23H,4,9-10H2,1-3H3/t18?,19?,21-,22+,23? |
| InChIKey | OYKGZZKPVBJWJX-BUFHDDOSSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|