C32H53N — CID 129147234
(6E,8Z)-N,2,4-trimethyl-N-(2-methylbutan-2-yl)-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-propan-2-yl-6-[(Z)-prop-1-enyl]deca-6,8-dien-2-amine (PubChem CID 129147234) has the molecular formula C32H53N and a molecular weight of 451.78 g/mol. Its IUPAC name is (6E,8Z)-N,2,4-trimethyl-N-(2-methylbutan-2-yl)-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-propan-2-yl-6-[(Z)-prop-1-enyl]deca-6,8-dien-2-amine.
| Compound Name | (6E,8Z)-N,2,4-trimethyl-N-(2-methylbutan-2-yl)-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-propan-2-yl-6-[(Z)-prop-1-enyl]deca-6,8-dien-2-amine |
|---|---|
| PubChem CID | 129147234 |
| Molecular Formula | C32H53N |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.42 |
| IUPAC Name | (6E,8Z)-N,2,4-trimethyl-N-(2-methylbutan-2-yl)-5-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-propan-2-yl-6-[(Z)-prop-1-enyl]deca-6,8-dien-2-amine |
| SMILES | C=C/C=C\C(=C/C=C)C(C(/C=C\C)=C/C=C\C)(C(C)C)C(C)CC(C)(C)N(C)C(C)(C)CC |
| InChI | InChI=1S/C32H53N/c1-14-19-23-28(21-16-3)32(26(6)7,29(22-17-4)24-20-15-2)27(8)25-31(11,12)33(13)30(9,10)18-5/h14-17,19-24,26-27H,1,3,18,25H2,2,4-13H3/b20-15-,22-17-,23-19-,28-21+,29-24+ |
| InChIKey | QUVDZCGUIGYLBF-UDLJXZPRSA-N |
| XLogP | 9.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|