C11H16O3 — CID 12914729
1,1-Dimethylethyl 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 12914729) has the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. Its IUPAC name is tert-butyl 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 1,1-Dimethylethyl 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 12914729 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | tert-butyl 7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC2C=CC1O2 |
| InChI | InChI=1S/C11H16O3/c1-11(2,3)14-10(12)8-6-7-4-5-9(8)13-7/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | DXHDZCWHXALEEV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 275 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|