C17H11BrO3 — CID 129147418
4-(5-bromo-2-ethylphenyl)-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one (PubChem CID 129147418) has the molecular formula C17H11BrO3 and a molecular weight of 343.18 g/mol. Its IUPAC name is 4-(5-bromo-2-ethylphenyl)-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one.
| Compound Name | 4-(5-bromo-2-ethylphenyl)-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one |
|---|---|
| PubChem CID | 129147418 |
| Molecular Formula | C17H11BrO3 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 4-(5-bromo-2-ethylphenyl)-5-hydroxy-10-oxatricyclo[5.2.1.02,6]deca-1,4,6,8-tetraen-3-one |
| SMILES | CCc1ccc(Br)cc1C1=C(O)c2c(c3ccc2o3)C1=O |
| InChI | InChI=1S/C17H11BrO3/c1-2-8-3-4-9(18)7-10(8)13-16(19)14-11-5-6-12(21-11)15(14)17(13)20/h3-7,19H,2H2,1H3 |
| InChIKey | VXDNZXVUFFVQDJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|