About 2-diazenyl-N'-methylprop-2-enimidamide
2-diazenyl-N'-methylprop-2-enimidamide (PubChem CID 129147718) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is 2-diazenyl-N'-methylprop-2-enimidamide.
Molecular Properties
| Compound Name | 2-diazenyl-N'-methylprop-2-enimidamide |
| PubChem CID | 129147718 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | 2-diazenyl-N'-methylprop-2-enimidamide |
| SMILES | [H]/N=N/C(=C)/C(N)=N/C |
| InChI | InChI=1S/C4H8N4/c1-3(8-6)4(5)7-2/h6H,1H2,2H3,(H2,5,7)/b8-6+ |
| InChIKey | DQOAVUPCKKYDFG-SOFGYWHQSA-N |
| XLogP | 0.52 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenyl-N'-methylprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenyl-N'-methylprop-2-enimidamide?
The IUPAC name of 2-diazenyl-N'-methylprop-2-enimidamide (CID 129147718) is 2-diazenyl-N'-methylprop-2-enimidamide.
What is the SMILES notation for 2-diazenyl-N'-methylprop-2-enimidamide?
The canonical SMILES for 2-diazenyl-N'-methylprop-2-enimidamide is [H]/N=N/C(=C)/C(N)=N/C.
What is the InChIKey of 2-diazenyl-N'-methylprop-2-enimidamide?
The InChIKey is DQOAVUPCKKYDFG-SOFGYWHQSA-N. The full InChI is InChI=1S/C4H8N4/c1-3(8-6)4(5)7-2/h6H,1H2,2H3,(H2,5,7)/b8-6+.
What are the key properties of 2-diazenyl-N'-methylprop-2-enimidamide?
2-diazenyl-N'-methylprop-2-enimidamide has a molecular weight of 112.14 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenyl-N'-methylprop-2-enimidamide is sourced from PubChem (CID 129147718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).