About 3a,7a-dihydro-1-benzofuran-4,7-diamine
3a,7a-dihydro-1-benzofuran-4,7-diamine (PubChem CID 129147829) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3a,7a-dihydro-1-benzofuran-4,7-diamine.
Molecular Properties
| Compound Name | 3a,7a-dihydro-1-benzofuran-4,7-diamine |
| PubChem CID | 129147829 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3a,7a-dihydro-1-benzofuran-4,7-diamine |
| SMILES | NC1=CC=C(N)C2OC=CC12 |
| InChI | InChI=1S/C8H10N2O/c9-6-1-2-7(10)8-5(6)3-4-11-8/h1-5,8H,9-10H2 |
| InChIKey | MVAWWIPBMMPESQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a,7a-dihydro-1-benzofuran-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dihydro-1-benzofuran-4,7-diamine?
The IUPAC name of 3a,7a-dihydro-1-benzofuran-4,7-diamine (CID 129147829) is 3a,7a-dihydro-1-benzofuran-4,7-diamine.
What is the SMILES notation for 3a,7a-dihydro-1-benzofuran-4,7-diamine?
The canonical SMILES for 3a,7a-dihydro-1-benzofuran-4,7-diamine is NC1=CC=C(N)C2OC=CC12.
What is the InChIKey of 3a,7a-dihydro-1-benzofuran-4,7-diamine?
The InChIKey is MVAWWIPBMMPESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c9-6-1-2-7(10)8-5(6)3-4-11-8/h1-5,8H,9-10H2.
What are the key properties of 3a,7a-dihydro-1-benzofuran-4,7-diamine?
3a,7a-dihydro-1-benzofuran-4,7-diamine has a molecular weight of 150.18 g/mol, XLogP of 0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dihydro-1-benzofuran-4,7-diamine is sourced from PubChem (CID 129147829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).