C17H25FN6O4 — CID 129147917
[(2R,3R,4R,5R)-5-(4-amino-2-methylidene-1-pyridinyl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl 2-amino-3-methylbutanoate (PubChem CID 129147917) has the molecular formula C17H25FN6O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-methylidene-1-pyridinyl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl 2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-methylidene-1-pyridinyl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 129147917 |
| Molecular Formula | C17H25FN6O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-methylidene-1-pyridinyl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl 2-amino-3-methylbutanoate |
| SMILES | C=C1C=C(N)C=CN1[C@@H]1O[C@](CN=[N+]=[N-])(COC(=O)C(N)C(C)C)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C17H25FN6O4/c1-9(2)13(20)16(26)27-8-17(7-22-23-21)14(25)12(18)15(28-17)24-5-4-11(19)6-10(24)3/h4-6,9,12-15,25H,3,7-8,19-20H2,1-2H3/t12-,13?,14+,15-,17-/m1/s1 |
| InChIKey | MZSSCLJMVWUROP-YYVZMHJZSA-N |
| XLogP | 0.80 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|