C17H23N3O3 — CID 129147994
2-acetyl-10-amino-9-methoxy-7,7-dimethyl-1,3,6,11b-tetrahydropyrazino[2,1-a]isoquinolin-4-one (PubChem CID 129147994) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-acetyl-10-amino-9-methoxy-7,7-dimethyl-1,3,6,11b-tetrahydropyrazino[2,1-a]isoquinolin-4-one.
| Compound Name | 2-acetyl-10-amino-9-methoxy-7,7-dimethyl-1,3,6,11b-tetrahydropyrazino[2,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 129147994 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-acetyl-10-amino-9-methoxy-7,7-dimethyl-1,3,6,11b-tetrahydropyrazino[2,1-a]isoquinolin-4-one |
| SMILES | COc1cc2c(cc1N)C1CN(C(C)=O)CC(=O)N1CC2(C)C |
| InChI | InChI=1S/C17H23N3O3/c1-10(21)19-7-14-11-5-13(18)15(23-4)6-12(11)17(2,3)9-20(14)16(22)8-19/h5-6,14H,7-9,18H2,1-4H3 |
| InChIKey | UIBDZQFYMNBFKR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|