C26H29ClN6O4S — CID 129148000
10-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-9-methoxy-1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one (PubChem CID 129148000) has the molecular formula C26H29ClN6O4S and a molecular weight of 557.08 g/mol. Its IUPAC name is 10-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-9-methoxy-1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one.
| Compound Name | 10-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-9-methoxy-1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 129148000 |
| Molecular Formula | C26H29ClN6O4S |
| Molecular Weight | 557.08 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 10-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-9-methoxy-1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(Nc3ccccc3S(=O)(=O)C(C)C)n1)C1CNCC(=O)N1CC2 |
| InChI | InChI=1S/C26H29ClN6O4S/c1-15(2)38(35,36)23-7-5-4-6-19(23)30-25-18(27)12-29-26(32-25)31-20-11-17-16(10-22(20)37-3)8-9-33-21(17)13-28-14-24(33)34/h4-7,10-12,15,21,28H,8-9,13-14H2,1-3H3,(H2,29,30,31,32) |
| InChIKey | LVBJEZPSLPIGDT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.08 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |