C54H40N6S2 — CID 129148134
2-[3-(9,9-dimethylacridin-10-yl)-5-[3-(9,9-dimethylacridin-10-yl)-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 129148134) has the molecular formula C54H40N6S2 and a molecular weight of 837.09 g/mol. Its IUPAC name is 2-[3-(9,9-dimethylacridin-10-yl)-5-[3-(9,9-dimethylacridin-10-yl)-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-[3-(9,9-dimethylacridin-10-yl)-5-[3-(9,9-dimethylacridin-10-yl)-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 129148134 |
| Molecular Formula | C54H40N6S2 |
| Molecular Weight | 837.09 g/mol |
| Exact Mass | 836.28 |
| IUPAC Name | 2-[3-(9,9-dimethylacridin-10-yl)-5-[3-(9,9-dimethylacridin-10-yl)-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CC1(C)c2ccccc2N(c2cc(-c3cc(-c4nc5cccnc5s4)cc(N4c5ccccc5C(C)(C)c5ccccc54)c3)cc(-c3nc4cccnc4s3)c2)c2ccccc21 |
| InChI | InChI=1S/C54H40N6S2/c1-53(2)39-15-5-9-21-45(39)59(46-22-10-6-16-40(46)53)37-29-33(27-35(31-37)49-57-43-19-13-25-55-51(43)61-49)34-28-36(50-58-44-20-14-26-56-52(44)62-50)32-38(30-34)60-47-23-11-7-17-41(47)54(3,4)42-18-8-12-24-48(42)60/h5-32H,1-4H3 |
| InChIKey | QPOKAQODPIOMAS-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.09 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |