About 4-(aminomethyl)-2,3-dihydrochromen-4-ol
4-(aminomethyl)-2,3-dihydrochromen-4-ol (PubChem CID 12914867) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-(aminomethyl)-2,3-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 4-(aminomethyl)-2,3-dihydrochromen-4-ol |
| PubChem CID | 12914867 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-(aminomethyl)-2,3-dihydrochromen-4-ol |
| SMILES | NCC1(O)CCOc2ccccc21 |
| InChI | InChI=1S/C10H13NO2/c11-7-10(12)5-6-13-9-4-2-1-3-8(9)10/h1-4,12H,5-7,11H2 |
| InChIKey | LJIMCZDPGHYLKP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)-2,3-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-2,3-dihydrochromen-4-ol?
The IUPAC name of 4-(aminomethyl)-2,3-dihydrochromen-4-ol (CID 12914867) is 4-(aminomethyl)-2,3-dihydrochromen-4-ol.
What is the SMILES notation for 4-(aminomethyl)-2,3-dihydrochromen-4-ol?
The canonical SMILES for 4-(aminomethyl)-2,3-dihydrochromen-4-ol is NCC1(O)CCOc2ccccc21.
What is the InChIKey of 4-(aminomethyl)-2,3-dihydrochromen-4-ol?
The InChIKey is LJIMCZDPGHYLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-7-10(12)5-6-13-9-4-2-1-3-8(9)10/h1-4,12H,5-7,11H2.
What are the key properties of 4-(aminomethyl)-2,3-dihydrochromen-4-ol?
4-(aminomethyl)-2,3-dihydrochromen-4-ol has a molecular weight of 179.22 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-2,3-dihydrochromen-4-ol is sourced from PubChem (CID 12914867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).