C17H10F8O — CID 12914884
[(E)-1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-phenylethenyl]benzene (PubChem CID 12914884) has the molecular formula C17H10F8O and a molecular weight of 382.25 g/mol. Its IUPAC name is [(E)-1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-phenylethenyl]benzene.
| Compound Name | [(E)-1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 12914884 |
| Molecular Formula | C17H10F8O |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | [(E)-1-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-2-phenylethenyl]benzene |
| SMILES | F/C(=C(/OC(F)(F)C(F)(F)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H10F8O/c18-13(11-7-3-1-4-8-11)14(12-9-5-2-6-10-12)26-17(24,25)15(19,20)16(21,22)23/h1-10H/b14-13+ |
| InChIKey | QPLFJIVQKXCCLB-BUHFOSPRSA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|