C21H38BrN2O8+ — CID 129148850
2-[2-bromo-5-(2-hydroxyethylcarbamoyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoyl]oxyethyl-(carboxymethyl)-dimethylazanium (PubChem CID 129148850) has the molecular formula C21H38BrN2O8+ and a molecular weight of 526.45 g/mol. Its IUPAC name is 2-[2-bromo-5-(2-hydroxyethylcarbamoyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoyl]oxyethyl-(carboxymethyl)-dimethylazanium.
| Compound Name | 2-[2-bromo-5-(2-hydroxyethylcarbamoyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoyl]oxyethyl-(carboxymethyl)-dimethylazanium |
|---|---|
| PubChem CID | 129148850 |
| Molecular Formula | C21H38BrN2O8+ |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[2-bromo-5-(2-hydroxyethylcarbamoyl)-8-methoxy-2,7,7-trimethyl-8-oxooctanoyl]oxyethyl-(carboxymethyl)-dimethylazanium |
| SMILES | COC(=O)C(C)(C)CC(CCC(C)(Br)C(=O)OCC[N+](C)(C)CC(=O)O)C(=O)NCCO |
| InChI | InChI=1S/C21H37BrN2O8/c1-20(2,18(29)31-6)13-15(17(28)23-9-11-25)7-8-21(3,22)19(30)32-12-10-24(4,5)14-16(26)27/h15,25H,7-14H2,1-6H3,(H-,23,26,27,28)/p+1 |
| InChIKey | JDYGUTJQJOAZKV-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|