About 5-bromo-2,6-dimethylfuro[3,2-b]furan
5-bromo-2,6-dimethylfuro[3,2-b]furan (PubChem CID 129149223) has the molecular formula C8H7BrO2
and a molecular weight of 215.05 g/mol. Its IUPAC name is 5-bromo-2,6-dimethylfuro[3,2-b]furan.
Molecular Properties
| Compound Name | 5-bromo-2,6-dimethylfuro[3,2-b]furan |
| PubChem CID | 129149223 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 5-bromo-2,6-dimethylfuro[3,2-b]furan |
| SMILES | Cc1cc2oc(Br)c(C)c2o1 |
| InChI | InChI=1S/C8H7BrO2/c1-4-3-6-7(10-4)5(2)8(9)11-6/h3H,1-2H3 |
| InChIKey | XCIPOAWEGHDBNT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2,6-dimethylfuro[3,2-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,6-dimethylfuro[3,2-b]furan?
The IUPAC name of 5-bromo-2,6-dimethylfuro[3,2-b]furan (CID 129149223) is 5-bromo-2,6-dimethylfuro[3,2-b]furan.
What is the SMILES notation for 5-bromo-2,6-dimethylfuro[3,2-b]furan?
The canonical SMILES for 5-bromo-2,6-dimethylfuro[3,2-b]furan is Cc1cc2oc(Br)c(C)c2o1.
What is the InChIKey of 5-bromo-2,6-dimethylfuro[3,2-b]furan?
The InChIKey is XCIPOAWEGHDBNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO2/c1-4-3-6-7(10-4)5(2)8(9)11-6/h3H,1-2H3.
What are the key properties of 5-bromo-2,6-dimethylfuro[3,2-b]furan?
5-bromo-2,6-dimethylfuro[3,2-b]furan has a molecular weight of 215.05 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,6-dimethylfuro[3,2-b]furan is sourced from PubChem (CID 129149223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).