C9H19N — CID 129149436
cis-(1R,3S)-3-ethyl-N-methylcyclohexan-1-amine (PubChem CID 129149436) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is cis-(1R,3S)-3-ethyl-N-methylcyclohexan-1-amine.
| Compound Name | cis-(1R,3S)-3-ethyl-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 129149436 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | cis-(1R,3S)-3-ethyl-N-methylcyclohexan-1-amine |
| SMILES | CC[C@H]1CCC[C@@H](NC)C1 |
| InChI | InChI=1S/C9H19N/c1-3-8-5-4-6-9(7-8)10-2/h8-10H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | DQOAFOFILLTJBX-DTWKUNHWSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |