About 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid
6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid (PubChem CID 129149506) has the molecular formula C11H13NO4S
and a molecular weight of 255.29 g/mol. Its IUPAC name is 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid.
Molecular Properties
| Compound Name | 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid |
| PubChem CID | 129149506 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid |
| SMILES | CC(=O)c1cc2c(c(S(=O)(=O)O)c1)CN(C)C2 |
| InChI | InChI=1S/C11H13NO4S/c1-7(13)8-3-9-5-12(2)6-10(9)11(4-8)17(14,15)16/h3-4H,5-6H2,1-2H3,(H,14,15,16) |
| InChIKey | FRIMNDLJSCUIEU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid?
The IUPAC name of 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid (CID 129149506) is 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid.
What is the SMILES notation for 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid?
The canonical SMILES for 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid is CC(=O)c1cc2c(c(S(=O)(=O)O)c1)CN(C)C2.
What is the InChIKey of 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid?
The InChIKey is FRIMNDLJSCUIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4S/c1-7(13)8-3-9-5-12(2)6-10(9)11(4-8)17(14,15)16/h3-4H,5-6H2,1-2H3,(H,14,15,16).
What are the key properties of 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid?
6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid has a molecular weight of 255.29 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-2-methyl-1,3-dihydroisoindole-4-sulfonic acid is sourced from PubChem (CID 129149506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).