About 1H-pyrrole-2,3,5-tricarbaldehyde
1H-pyrrole-2,3,5-tricarbaldehyde (PubChem CID 12914964) has the molecular formula C7H5NO3
and a molecular weight of 151.12 g/mol. Its IUPAC name is 1H-pyrrole-2,3,5-tricarbaldehyde.
Molecular Properties
| Compound Name | 1H-pyrrole-2,3,5-tricarbaldehyde |
| PubChem CID | 12914964 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 1H-pyrrole-2,3,5-tricarbaldehyde |
| SMILES | O=Cc1cc(C=O)c(C=O)[nH]1 |
| InChI | InChI=1S/C7H5NO3/c9-2-5-1-6(3-10)8-7(5)4-11/h1-4,8H |
| InChIKey | VUXRQLMUKQMWRO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrole-2,3,5-tricarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-2,3,5-tricarbaldehyde?
The IUPAC name of 1H-pyrrole-2,3,5-tricarbaldehyde (CID 12914964) is 1H-pyrrole-2,3,5-tricarbaldehyde.
What is the SMILES notation for 1H-pyrrole-2,3,5-tricarbaldehyde?
The canonical SMILES for 1H-pyrrole-2,3,5-tricarbaldehyde is O=Cc1cc(C=O)c(C=O)[nH]1.
What is the InChIKey of 1H-pyrrole-2,3,5-tricarbaldehyde?
The InChIKey is VUXRQLMUKQMWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3/c9-2-5-1-6(3-10)8-7(5)4-11/h1-4,8H.
What are the key properties of 1H-pyrrole-2,3,5-tricarbaldehyde?
1H-pyrrole-2,3,5-tricarbaldehyde has a molecular weight of 151.12 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-2,3,5-tricarbaldehyde is sourced from PubChem (CID 12914964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).