C12H14ClFN6 — CID 129149976
2-N-(5-chloro-2-fluoro-3,6-dimethyl-4-pyridinyl)-4-N,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 129149976) has the molecular formula C12H14ClFN6 and a molecular weight of 296.74 g/mol. Its IUPAC name is 2-N-(5-chloro-2-fluoro-3,6-dimethyl-4-pyridinyl)-4-N,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(5-chloro-2-fluoro-3,6-dimethyl-4-pyridinyl)-4-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129149976 |
| Molecular Formula | C12H14ClFN6 |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-N-(5-chloro-2-fluoro-3,6-dimethyl-4-pyridinyl)-4-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(C)nc(Nc2c(C)c(F)nc(C)c2Cl)n1 |
| InChI | InChI=1S/C12H14ClFN6/c1-5-9(8(13)6(2)16-10(5)14)19-12-18-7(3)17-11(15-4)20-12/h1-4H3,(H2,15,16,17,18,19,20) |
| InChIKey | LILDHWOQIRKCFA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|