About N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine
N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine (PubChem CID 129150399) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine |
| PubChem CID | 129150399 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine |
| SMILES | C=C(C)C(=C)OCCN(CCC)CCC |
| InChI | InChI=1S/C13H25NO/c1-6-8-14(9-7-2)10-11-15-13(5)12(3)4/h3,5-11H2,1-2,4H3 |
| InChIKey | AXJBERVDMIGHPE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine?
The IUPAC name of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine (CID 129150399) is N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine.
What is the SMILES notation for N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine?
The canonical SMILES for N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine is C=C(C)C(=C)OCCN(CCC)CCC.
What is the InChIKey of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine?
The InChIKey is AXJBERVDMIGHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-6-8-14(9-7-2)10-11-15-13(5)12(3)4/h3,5-11H2,1-2,4H3.
What are the key properties of N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine?
N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine has a molecular weight of 211.35 g/mol, XLogP of 3.21, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-N-propylpropan-1-amine is sourced from PubChem (CID 129150399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).