C26H23F2NO6 — CID 129150568
methyl (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate (PubChem CID 129150568) has the molecular formula C26H23F2NO6 and a molecular weight of 483.47 g/mol. Its IUPAC name is methyl (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate.
| Compound Name | methyl (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
|---|---|
| PubChem CID | 129150568 |
| Molecular Formula | C26H23F2NO6 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | methyl (2S,3R,4R,5S,6R)-6-[4-(difluoromethyl)phenyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3c(OC)cncc3O[C@@]2(c2ccc(C(F)F)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H23F2NO6/c1-33-17-12-29-13-18-21(17)25(32)22(30)19(24(31)34-2)20(14-6-4-3-5-7-14)26(25,35-18)16-10-8-15(9-11-16)23(27)28/h3-13,19-20,22-23,30,32H,1-2H3/t19-,20-,22-,25+,26+/m1/s1 |
| InChIKey | VVXUBWOOAQGAHM-YHVMUTAASA-N |
| XLogP | 3.45 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |