C26H23BrClNO8S — CID 129150607
methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-12-methoxy-3-methylsulfonyloxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate (PubChem CID 129150607) has the molecular formula C26H23BrClNO8S and a molecular weight of 624.89 g/mol. Its IUPAC name is methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-12-methoxy-3-methylsulfonyloxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate.
| Compound Name | methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-12-methoxy-3-methylsulfonyloxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
|---|---|
| PubChem CID | 129150607 |
| Molecular Formula | C26H23BrClNO8S |
| Molecular Weight | 624.89 g/mol |
| Exact Mass | 623.00 |
| IUPAC Name | methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-12-methoxy-3-methylsulfonyloxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](OS(C)(=O)=O)[C@@]2(O)c3c(cc(Cl)nc3OC)O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H23BrClNO8S/c1-34-23-21-17(13-18(28)29-23)36-26(15-9-11-16(27)12-10-15)20(14-7-5-4-6-8-14)19(24(30)35-2)22(25(21,26)31)37-38(3,32)33/h4-13,19-20,22,31H,1-3H3/t19-,20-,22-,25+,26+/m1/s1 |
| InChIKey | GOWLDZMAVNGUGA-YHVMUTAASA-N |
| XLogP | 3.91 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|