C26H24BrNO7 — CID 129150615
methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate (PubChem CID 129150615) has the molecular formula C26H24BrNO7 and a molecular weight of 542.38 g/mol. Its IUPAC name is methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate.
| Compound Name | methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
|---|---|
| PubChem CID | 129150615 |
| Molecular Formula | C26H24BrNO7 |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | methyl (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-10,12-dimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3c(cc(OC)nc3OC)O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H24BrNO7/c1-32-18-13-17-21(23(28-18)33-2)25(31)22(29)19(24(30)34-3)20(14-7-5-4-6-8-14)26(25,35-17)15-9-11-16(27)12-10-15/h4-13,19-20,22,29,31H,1-3H3/t19-,20-,22-,25+,26+/m1/s1 |
| InChIKey | RLPQINXRFNWGFV-YHVMUTAASA-N |
| XLogP | 3.28 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |