C29H28F3N2O6P — CID 129150638
[(2S,3R,4R,5R,6R)-2,3-dihydroxy-12-methoxy-5-phenylphosphanyl-6-[4-(trifluoromethyl)phenyl]-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]-morpholin-4-ylmethanone (PubChem CID 129150638) has the molecular formula C29H28F3N2O6P and a molecular weight of 588.52 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-2,3-dihydroxy-12-methoxy-5-phenylphosphanyl-6-[4-(trifluoromethyl)phenyl]-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S,3R,4R,5R,6R)-2,3-dihydroxy-12-methoxy-5-phenylphosphanyl-6-[4-(trifluoromethyl)phenyl]-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 129150638 |
| Molecular Formula | C29H28F3N2O6P |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-2,3-dihydroxy-12-methoxy-5-phenylphosphanyl-6-[4-(trifluoromethyl)phenyl]-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]-morpholin-4-ylmethanone |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](C(=O)N3CCOCC3)[C@@H](Pc3ccccc3)[C@]1(c1ccc(C(F)(F)F)cc1)O2 |
| InChI | InChI=1S/C29H28F3N2O6P/c1-38-20-15-33-16-21-23(20)27(37)24(35)22(26(36)34-11-13-39-14-12-34)25(41-19-5-3-2-4-6-19)28(27,40-21)17-7-9-18(10-8-17)29(30,31)32/h2-10,15-16,22,24-25,35,37,41H,11-14H2,1H3/t22-,24+,25+,27-,28-/m0/s1 |
| InChIKey | PUFUDMIQFIBDHE-OQSWBUQJSA-N |
| XLogP | 2.81 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|