C20H30N2O — CID 129151292
(1S,13R)-1,13-dimethyl-10-(3-methylbutyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 129151292) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S,13R)-1,13-dimethyl-10-(3-methylbutyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1S,13R)-1,13-dimethyl-10-(3-methylbutyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 129151292 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (1S,13R)-1,13-dimethyl-10-(3-methylbutyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | CC(C)CCN1CC[C@]2(C)c3cc(C(N)=O)ccc3CC1[C@@H]2C |
| InChI | InChI=1S/C20H30N2O/c1-13(2)7-9-22-10-8-20(4)14(3)18(22)12-15-5-6-16(19(21)23)11-17(15)20/h5-6,11,13-14,18H,7-10,12H2,1-4H3,(H2,21,23)/t14-,18?,20-/m0/s1 |
| InChIKey | SRNPMMAKEODNDI-GUVZCDSQSA-N |
| XLogP | 3.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |