About N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine
N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine (PubChem CID 129151482) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| PubChem CID | 129151482 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| SMILES | CNc1noc2ncccc12 |
| InChI | InChI=1S/C7H7N3O/c1-8-6-5-3-2-4-9-7(5)11-10-6/h2-4H,1H3,(H,8,10) |
| InChIKey | NRMWCDJVPHXLAE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The IUPAC name of N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine (CID 129151482) is N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine.
What is the SMILES notation for N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The canonical SMILES for N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine is CNc1noc2ncccc12.
What is the InChIKey of N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The InChIKey is NRMWCDJVPHXLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-8-6-5-3-2-4-9-7(5)11-10-6/h2-4H,1H3,(H,8,10).
What are the key properties of N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine has a molecular weight of 149.15 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine is sourced from PubChem (CID 129151482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).