C17H20O7 — CID 129151545
(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,3Z)-2-ethylidenehexa-3,5-dienoate (PubChem CID 129151545) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,3Z)-2-ethylidenehexa-3,5-dienoate.
| Compound Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,3Z)-2-ethylidenehexa-3,5-dienoate |
|---|---|
| PubChem CID | 129151545 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,3Z)-2-ethylidenehexa-3,5-dienoate |
| SMILES | C=C/C=C\C(=C/C)C(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12 |
| InChI | InChI=1S/C17H20O7/c1-5-7-8-9(6-2)14(18)21-12-10-11(20-15(12)19)13-16(22-10)24-17(3,4)23-13/h5-8,10-13,16H,1H2,2-4H3/b8-7-,9-6+ |
| InChIKey | ANLDECNGCFBKRR-SOKJVCRVSA-N |
| XLogP | 1.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|