C19H22O7 — CID 129151546
(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate (PubChem CID 129151546) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate.
| Compound Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 129151546 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) (2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienoate |
| SMILES | C=C/C=C(\C=C/C)/C=C/C(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12 |
| InChI | InChI=1S/C19H22O7/c1-5-7-11(8-6-2)9-10-12(20)22-15-13-14(23-17(15)21)16-18(24-13)26-19(3,4)25-16/h5-10,13-16,18H,1H2,2-4H3/b8-6-,10-9+,11-7+ |
| InChIKey | GXSWOQASIUFTCU-CLZVIZHTSA-N |
| XLogP | 1.94 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|