C29H48O — CID 129151595
(E)-16-(3,4-dimethylphenyl)-2,6,10,10,14-pentamethylhexadec-5-enal (PubChem CID 129151595) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is (E)-16-(3,4-dimethylphenyl)-2,6,10,10,14-pentamethylhexadec-5-enal.
| Compound Name | (E)-16-(3,4-dimethylphenyl)-2,6,10,10,14-pentamethylhexadec-5-enal |
|---|---|
| PubChem CID | 129151595 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | (E)-16-(3,4-dimethylphenyl)-2,6,10,10,14-pentamethylhexadec-5-enal |
| SMILES | C/C(=C\CCC(C)C=O)CCCC(C)(C)CCCC(C)CCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C29H48O/c1-23(11-8-12-25(3)22-30)13-9-19-29(6,7)20-10-14-24(2)15-17-28-18-16-26(4)27(5)21-28/h11,16,18,21-22,24-25H,8-10,12-15,17,19-20H2,1-7H3/b23-11+ |
| InChIKey | DWIDWIZYPKYABK-FOKLQQMPSA-N |
| XLogP | 8.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|