About 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol
3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol (PubChem CID 129151615) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol |
| PubChem CID | 129151615 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1CC(CN)=CC(O)C1C |
| InChI | InChI=1S/C9H17NO/c1-6-3-8(5-10)4-9(11)7(6)2/h4,6-7,9,11H,3,5,10H2,1-2H3 |
| InChIKey | HEDZOUWACMNSIN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol?
The IUPAC name of 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol (CID 129151615) is 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol.
What is the SMILES notation for 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol?
The canonical SMILES for 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol is CC1CC(CN)=CC(O)C1C.
What is the InChIKey of 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol?
The InChIKey is HEDZOUWACMNSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-6-3-8(5-10)4-9(11)7(6)2/h4,6-7,9,11H,3,5,10H2,1-2H3.
What are the key properties of 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol?
3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol has a molecular weight of 155.24 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-5,6-dimethylcyclohex-2-en-1-ol is sourced from PubChem (CID 129151615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).