About 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine
2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine (PubChem CID 12915194) has the molecular formula C17H18N2
and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine.
Molecular Properties
| Compound Name | 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine |
| PubChem CID | 12915194 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine |
| SMILES | CCC1=NC(c2ccccc2)Cc2ccccc2N1 |
| InChI | InChI=1S/C17H18N2/c1-2-17-18-15-11-7-6-10-14(15)12-16(19-17)13-8-4-3-5-9-13/h3-11,16H,2,12H2,1H3,(H,18,19) |
| InChIKey | SYKICRHYNSNRCF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine?
The IUPAC name of 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine (CID 12915194) is 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine.
What is the SMILES notation for 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine?
The canonical SMILES for 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine is CCC1=NC(c2ccccc2)Cc2ccccc2N1.
What is the InChIKey of 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine?
The InChIKey is SYKICRHYNSNRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2/c1-2-17-18-15-11-7-6-10-14(15)12-16(19-17)13-8-4-3-5-9-13/h3-11,16H,2,12H2,1H3,(H,18,19).
What are the key properties of 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine?
2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine has a molecular weight of 250.35 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-phenyl-4,5-dihydro-1H-1,3-benzodiazepine is sourced from PubChem (CID 12915194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).