C19H26F2O6S — CID 129152283
3-(benzenesulfonyl)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol (PubChem CID 129152283) has the molecular formula C19H26F2O6S and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol.
| Compound Name | 3-(benzenesulfonyl)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 129152283 |
| Molecular Formula | C19H26F2O6S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-(benzenesulfonyl)-3,3-difluoro-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propane-1,2-diol |
| SMILES | CC(C)=C[C@]1(C)OC(C)(C)O[C@@H]1C(O)(CO)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26F2O6S/c1-13(2)11-17(5)15(26-16(3,4)27-17)18(23,12-22)19(20,21)28(24,25)14-9-7-6-8-10-14/h6-11,15,22-23H,12H2,1-5H3/t15-,17-,18?/m0/s1 |
| InChIKey | WYILKGDHHVCCOY-LUIZSJORSA-N |
| XLogP | 2.65 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|