About CID 129152422
CID 129152422 (PubChem CID 129152422) has the molecular formula C11H22NS-
and a molecular weight of 200.37 g/mol.
Molecular Properties
| Compound Name | CID 129152422 |
| PubChem CID | 129152422 |
| Molecular Formula | C11H22NS- |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | — |
| SMILES | C#[S-](CNCC(C)C)C(=C)C(C)C |
| InChI | InChI=1S/C11H22NS/c1-9(2)7-12-8-13(6)11(5)10(3)4/h6,9-10,12H,5,7-8H2,1-4H3/q-1 |
| InChIKey | QTKARGVMVNZJJJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 129152422 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 129152422?
The IUPAC name of CID 129152422 (CID 129152422) is not available.
What is the SMILES notation for CID 129152422?
The canonical SMILES for CID 129152422 is C#[S-](CNCC(C)C)C(=C)C(C)C.
What is the InChIKey of CID 129152422?
The InChIKey is QTKARGVMVNZJJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22NS/c1-9(2)7-12-8-13(6)11(5)10(3)4/h6,9-10,12H,5,7-8H2,1-4H3/q-1.
What are the key properties of CID 129152422?
CID 129152422 has a molecular weight of 200.37 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 129152422 is sourced from PubChem (CID 129152422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).