About 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine
4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine (PubChem CID 129152816) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine.
Molecular Properties
| Compound Name | 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine |
| PubChem CID | 129152816 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine |
| SMILES | NC1=CNCC=C1Nc1ccn[nH]1 |
| InChI | InChI=1S/C8H11N5/c9-6-5-10-3-1-7(6)12-8-2-4-11-13-8/h1-2,4-5,10H,3,9H2,(H2,11,12,13) |
| InChIKey | WNPUBRWFKDSGFI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine?
The IUPAC name of 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine (CID 129152816) is 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine.
What is the SMILES notation for 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine?
The canonical SMILES for 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine is NC1=CNCC=C1Nc1ccn[nH]1.
What is the InChIKey of 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine?
The InChIKey is WNPUBRWFKDSGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c9-6-5-10-3-1-7(6)12-8-2-4-11-13-8/h1-2,4-5,10H,3,9H2,(H2,11,12,13).
What are the key properties of 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine?
4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine has a molecular weight of 177.21 g/mol, XLogP of 0.11, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(1H-pyrazol-5-yl)-1,2-dihydropyridine-4,5-diamine is sourced from PubChem (CID 129152816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).