C8H14N6 — CID 129153187
4-[amino(1H-pyrazol-5-yl)amino]-1,2,3,6-tetrahydropyridin-5-amine (PubChem CID 129153187) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-[amino(1H-pyrazol-5-yl)amino]-1,2,3,6-tetrahydropyridin-5-amine.
| Compound Name | 4-[amino(1H-pyrazol-5-yl)amino]-1,2,3,6-tetrahydropyridin-5-amine |
|---|---|
| PubChem CID | 129153187 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-[amino(1H-pyrazol-5-yl)amino]-1,2,3,6-tetrahydropyridin-5-amine |
| SMILES | NC1=C(N(N)c2ccn[nH]2)CCNC1 |
| InChI | InChI=1S/C8H14N6/c9-6-5-11-3-1-7(6)14(10)8-2-4-12-13-8/h2,4,11H,1,3,5,9-10H2,(H,12,13) |
| InChIKey | VGWCFSHPIKURGK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|