C8H15F3O2S — CID 129153537
(4S)-1,1,1-trifluoro-4-(methylsulfanylmethyl)hexane-2,2-diol (PubChem CID 129153537) has the molecular formula C8H15F3O2S and a molecular weight of 232.27 g/mol. Its IUPAC name is (4S)-1,1,1-trifluoro-4-(methylsulfanylmethyl)hexane-2,2-diol.
| Compound Name | (4S)-1,1,1-trifluoro-4-(methylsulfanylmethyl)hexane-2,2-diol |
|---|---|
| PubChem CID | 129153537 |
| Molecular Formula | C8H15F3O2S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (4S)-1,1,1-trifluoro-4-(methylsulfanylmethyl)hexane-2,2-diol |
| SMILES | CC[C@H](CSC)CC(O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3O2S/c1-3-6(5-14-2)4-7(12,13)8(9,10)11/h6,12-13H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | CXDCBMRAUDTBNT-LURJTMIESA-N |
| XLogP | 2.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|