About 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol
4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol (PubChem CID 129153585) has the molecular formula C10H19F3OS
and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol.
Molecular Properties
| Compound Name | 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol |
| PubChem CID | 129153585 |
| Molecular Formula | C10H19F3OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol |
| SMILES | CCC(CC(C)(O)C(F)(F)F)C(C)SC |
| InChI | InChI=1S/C10H19F3OS/c1-5-8(7(2)15-4)6-9(3,14)10(11,12)13/h7-8,14H,5-6H2,1-4H3 |
| InChIKey | MLYLHGMZODHZDM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol?
The IUPAC name of 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol (CID 129153585) is 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol.
What is the SMILES notation for 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol?
The canonical SMILES for 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol is CCC(CC(C)(O)C(F)(F)F)C(C)SC.
What is the InChIKey of 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol?
The InChIKey is MLYLHGMZODHZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3OS/c1-5-8(7(2)15-4)6-9(3,14)10(11,12)13/h7-8,14H,5-6H2,1-4H3.
What are the key properties of 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol?
4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol has a molecular weight of 244.32 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,1,1-trifluoro-2-methyl-5-methylsulfanylhexan-2-ol is sourced from PubChem (CID 129153585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).