C29H39Cl2N3O3S — CID 129154014
N-[(2S)-2-[(3S,5R,6S)-6-[(3Z,5Z)-5-chlorohepta-1,3,5-trien-2-yl]-5-(5-chloro-3-pyridinyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]-N-methylcyclopropanesulfonamide (PubChem CID 129154014) has the molecular formula C29H39Cl2N3O3S and a molecular weight of 580.62 g/mol. Its IUPAC name is N-[(2S)-2-[(3S,5R,6S)-6-[(3Z,5Z)-5-chlorohepta-1,3,5-trien-2-yl]-5-(5-chloro-3-pyridinyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]-N-methylcyclopropanesulfonamide.
| Compound Name | N-[(2S)-2-[(3S,5R,6S)-6-[(3Z,5Z)-5-chlorohepta-1,3,5-trien-2-yl]-5-(5-chloro-3-pyridinyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]-N-methylcyclopropanesulfonamide |
|---|---|
| PubChem CID | 129154014 |
| Molecular Formula | C29H39Cl2N3O3S |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | N-[(2S)-2-[(3S,5R,6S)-6-[(3Z,5Z)-5-chlorohepta-1,3,5-trien-2-yl]-5-(5-chloro-3-pyridinyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]butyl]-N-methylcyclopropanesulfonamide |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cncc(Cl)c2)[C@@H](C(=C)/C=C\C(Cl)=C\C)N([C@@H](CC)CN(C)S(=O)(=O)C2CC2)C1=O |
| InChI | InChI=1S/C29H39Cl2N3O3S/c1-7-14-29(5)16-26(21-15-23(31)18-32-17-21)27(20(4)10-11-22(30)8-2)34(28(29)35)24(9-3)19-33(6)38(36,37)25-12-13-25/h7-8,10-11,15,17-18,24-27H,1,4,9,12-14,16,19H2,2-3,5-6H3/b11-10-,22-8-/t24-,26+,27+,29-/m0/s1 |
| InChIKey | YTSNEQGMNAYGAH-BECVBUKJSA-N |
| XLogP | 6.46 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|