C8H11F3O2 — CID 129154754
(2E,4E)-4-(2,2,2-trifluoroethoxy)hexa-2,4-dien-3-ol (PubChem CID 129154754) has the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. Its IUPAC name is (2E,4E)-4-(2,2,2-trifluoroethoxy)hexa-2,4-dien-3-ol.
| Compound Name | (2E,4E)-4-(2,2,2-trifluoroethoxy)hexa-2,4-dien-3-ol |
|---|---|
| PubChem CID | 129154754 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2E,4E)-4-(2,2,2-trifluoroethoxy)hexa-2,4-dien-3-ol |
| SMILES | C/C=C(O)\C(=C/C)OCC(F)(F)F |
| InChI | InChI=1S/C8H11F3O2/c1-3-6(12)7(4-2)13-5-8(9,10)11/h3-4,12H,5H2,1-2H3/b6-3+,7-4+ |
| InChIKey | NNSVVCORMQUSKQ-XOKGJFMYSA-N |
| XLogP | 2.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|