C12H15F3O2 — CID 129154793
2-[(2E,4Z,6E)-10,10,10-trifluorodeca-2,4,6-trien-2-yl]oxyacetaldehyde (PubChem CID 129154793) has the molecular formula C12H15F3O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-[(2E,4Z,6E)-10,10,10-trifluorodeca-2,4,6-trien-2-yl]oxyacetaldehyde.
| Compound Name | 2-[(2E,4Z,6E)-10,10,10-trifluorodeca-2,4,6-trien-2-yl]oxyacetaldehyde |
|---|---|
| PubChem CID | 129154793 |
| Molecular Formula | C12H15F3O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[(2E,4Z,6E)-10,10,10-trifluorodeca-2,4,6-trien-2-yl]oxyacetaldehyde |
| SMILES | C/C(=C\C=C/C=C/CCC(F)(F)F)OCC=O |
| InChI | InChI=1S/C12H15F3O2/c1-11(17-10-9-16)7-5-3-2-4-6-8-12(13,14)15/h2-5,7,9H,6,8,10H2,1H3/b4-2+,5-3-,11-7+ |
| InChIKey | IXXHQEARWCMTRK-HYIJJLJUSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|