C24H20ClN3O2S2 — CID 129154809
5-[[5-(N-(4-chlorophenyl)-4-methylanilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 129154809) has the molecular formula C24H20ClN3O2S2 and a molecular weight of 482.03 g/mol. Its IUPAC name is 5-[[5-(N-(4-chlorophenyl)-4-methylanilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(N-(4-chlorophenyl)-4-methylanilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 129154809 |
| Molecular Formula | C24H20ClN3O2S2 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 5-[[5-(N-(4-chlorophenyl)-4-methylanilino)thiophen-2-yl]methylidene]-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N(c2ccc(Cl)cc2)c2ccc(C=C3C(=O)N(C)C(=S)N(C)C3=O)s2)cc1 |
| InChI | InChI=1S/C24H20ClN3O2S2/c1-15-4-8-17(9-5-15)28(18-10-6-16(25)7-11-18)21-13-12-19(32-21)14-20-22(29)26(2)24(31)27(3)23(20)30/h4-14H,1-3H3 |
| InChIKey | YUHPRLRIYBPCHC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|